C25H21NO6 — CID 16569952
(2-butoxy-2-oxoethyl) 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)benzoate (PubChem CID 16569952) has the molecular formula C25H21NO6 and a molecular weight of 431.44 g/mol. Its IUPAC name is (2-butoxy-2-oxoethyl) 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)benzoate.
| Compound Name | (2-butoxy-2-oxoethyl) 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)benzoate |
|---|---|
| PubChem CID | 16569952 |
| Molecular Formula | C25H21NO6 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (2-butoxy-2-oxoethyl) 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)benzoate |
| SMILES | CCCCOC(=O)COC(=O)c1ccc(N2C(=O)c3cccc4cccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C25H21NO6/c1-2-3-14-31-21(27)15-32-25(30)17-10-12-18(13-11-17)26-23(28)19-8-4-6-16-7-5-9-20(22(16)19)24(26)29/h4-13H,2-3,14-15H2,1H3 |
| InChIKey | GENSLHWYYRFDKW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|