C27H16ClNO5 — CID 1341941
[2-(4-chlorophenyl)-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)benzoate (PubChem CID 1341941) has the molecular formula C27H16ClNO5 and a molecular weight of 469.88 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)benzoate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)benzoate |
|---|---|
| PubChem CID | 1341941 |
| Molecular Formula | C27H16ClNO5 |
| Molecular Weight | 469.88 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 4-(1,3-dioxobenzo[de]isoquinolin-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)c3cccc4cccc(c34)C2=O)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H16ClNO5/c28-19-11-7-16(8-12-19)23(30)15-34-27(33)18-9-13-20(14-10-18)29-25(31)21-5-1-3-17-4-2-6-22(24(17)21)26(29)32/h1-14H,15H2 |
| InChIKey | ZOPVFCPLRXZJOU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.88 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|