C26H19ClN2O6 — CID 16506172
[2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 16506172) has the molecular formula C26H19ClN2O6 and a molecular weight of 490.90 g/mol. Its IUPAC name is [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16506172 |
| Molecular Formula | C26H19ClN2O6 |
| Molecular Weight | 490.90 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | [2-oxo-2-[4-(propanoylamino)phenyl]ethyl] 2-(4-chlorophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCC(=O)Nc1ccc(C(=O)COC(=O)c2ccc3c(c2)C(=O)N(c2ccc(Cl)cc2)C3=O)cc1 |
| InChI | InChI=1S/C26H19ClN2O6/c1-2-23(31)28-18-8-3-15(4-9-18)22(30)14-35-26(34)16-5-12-20-21(13-16)25(33)29(24(20)32)19-10-6-17(27)7-11-19/h3-13H,2,14H2,1H3,(H,28,31) |
| InChIKey | SZVVAESXDXRFGD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.90 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|