C31H23NO5S — CID 3396516
[2-(4-methylphenyl)-2-oxoethyl] 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3396516) has the molecular formula C31H23NO5S and a molecular weight of 521.59 g/mol. Its IUPAC name is [2-(4-methylphenyl)-2-oxoethyl] 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(4-methylphenyl)-2-oxoethyl] 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3396516 |
| Molecular Formula | C31H23NO5S |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | [2-(4-methylphenyl)-2-oxoethyl] 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(Sc2ccc(N3C(=O)c4ccc(C(=O)OCC(=O)c5ccc(C)cc5)cc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C31H23NO5S/c1-19-3-7-21(8-4-19)28(33)18-37-31(36)22-9-16-26-27(17-22)30(35)32(29(26)34)23-10-14-25(15-11-23)38-24-12-5-20(2)6-13-24/h3-17H,18H2,1-2H3 |
| InChIKey | LSOLFWMTSVTOAQ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|