C24H16N2O7 — CID 16645533
[2-(4-nitrophenyl)-2-oxoethyl] 2-(4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 16645533) has the molecular formula C24H16N2O7 and a molecular weight of 444.40 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] 2-(4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] 2-(4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16645533 |
| Molecular Formula | C24H16N2O7 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] 2-(4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)OCC(=O)c4ccc([N+](=O)[O-])cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C24H16N2O7/c1-14-2-7-17(8-3-14)25-22(28)19-11-6-16(12-20(19)23(25)29)24(30)33-13-21(27)15-4-9-18(10-5-15)26(31)32/h2-12H,13H2,1H3 |
| InChIKey | WCGUNCGGEGHYOT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|