C30H20BrNO5S — CID 4557902
[2-(4-bromophenyl)-2-oxoethyl] 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 4557902) has the molecular formula C30H20BrNO5S and a molecular weight of 586.46 g/mol. Its IUPAC name is [2-(4-bromophenyl)-2-oxoethyl] 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(4-bromophenyl)-2-oxoethyl] 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 4557902 |
| Molecular Formula | C30H20BrNO5S |
| Molecular Weight | 586.46 g/mol |
| Exact Mass | 585.02 |
| IUPAC Name | [2-(4-bromophenyl)-2-oxoethyl] 2-[4-(4-methylphenyl)sulfanylphenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(Sc2ccc(N3C(=O)c4ccc(C(=O)OCC(=O)c5ccc(Br)cc5)cc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C30H20BrNO5S/c1-18-2-11-23(12-3-18)38-24-13-9-22(10-14-24)32-28(34)25-15-6-20(16-26(25)29(32)35)30(36)37-17-27(33)19-4-7-21(31)8-5-19/h2-16H,17H2,1H3 |
| InChIKey | MYAFIUDVXYJWIL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.46 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|