C25H18BrNO5 — CID 23931664
[2-(2,5-dimethylphenyl)-2-oxoethyl] 4-(5-bromo-1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 23931664) has the molecular formula C25H18BrNO5 and a molecular weight of 492.33 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 4-(5-bromo-1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 4-(5-bromo-1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 23931664 |
| Molecular Formula | C25H18BrNO5 |
| Molecular Weight | 492.33 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 4-(5-bromo-1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)c2ccc(N3C(=O)c4ccc(Br)cc4C3=O)cc2)c1 |
| InChI | InChI=1S/C25H18BrNO5/c1-14-3-4-15(2)20(11-14)22(28)13-32-25(31)16-5-8-18(9-6-16)27-23(29)19-10-7-17(26)12-21(19)24(27)30/h3-12H,13H2,1-2H3 |
| InChIKey | AMFQISPSTCLJPZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|