C31H22ClNO6 — CID 3386653
[2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(3-chloro-4-phenoxyphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3386653) has the molecular formula C31H22ClNO6 and a molecular weight of 539.97 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(3-chloro-4-phenoxyphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(3-chloro-4-phenoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3386653 |
| Molecular Formula | C31H22ClNO6 |
| Molecular Weight | 539.97 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | [2-(2,5-dimethylphenyl)-2-oxoethyl] 2-(3-chloro-4-phenoxyphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(C)c(C(=O)COC(=O)c2ccc3c(c2)C(=O)N(c2ccc(Oc4ccccc4)c(Cl)c2)C3=O)c1 |
| InChI | InChI=1S/C31H22ClNO6/c1-18-8-9-19(2)24(14-18)27(34)17-38-31(37)20-10-12-23-25(15-20)30(36)33(29(23)35)21-11-13-28(26(32)16-21)39-22-6-4-3-5-7-22/h3-16H,17H2,1-2H3 |
| InChIKey | HKPIBWYMSWIVBP-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.97 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|