C22H20ClNO5 — CID 1218325
(3,3-dimethyl-2-oxobutyl) 2-(3-chloro-4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 1218325) has the molecular formula C22H20ClNO5 and a molecular weight of 413.86 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-(3-chloro-4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2-(3-chloro-4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 1218325 |
| Molecular Formula | C22H20ClNO5 |
| Molecular Weight | 413.86 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2-(3-chloro-4-methylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)OCC(=O)C(C)(C)C)cc3C2=O)cc1Cl |
| InChI | InChI=1S/C22H20ClNO5/c1-12-5-7-14(10-17(12)23)24-19(26)15-8-6-13(9-16(15)20(24)27)21(28)29-11-18(25)22(2,3)4/h5-10H,11H2,1-4H3 |
| InChIKey | MAJLCBPMNWMYDP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.86 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|