C25H27NO5 — CID 3844719
(3,3-dimethyl-2-oxobutyl) 2-(2,6-diethylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 3844719) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-(2,6-diethylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2-(2,6-diethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 3844719 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2-(2,6-diethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | CCc1cccc(CC)c1N1C(=O)c2ccc(C(=O)OCC(=O)C(C)(C)C)cc2C1=O |
| InChI | InChI=1S/C25H27NO5/c1-6-15-9-8-10-16(7-2)21(15)26-22(28)18-12-11-17(13-19(18)23(26)29)24(30)31-14-20(27)25(3,4)5/h8-13H,6-7,14H2,1-5H3 |
| InChIKey | AWWLZUYENFNGTA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|