C26H16F3NO7 — CID 126184103
[2-(4-acetyloxyphenyl)-2-oxoethyl] 1,3-dioxo-2-[3-(trifluoromethyl)phenyl]isoindole-5-carboxylate (PubChem CID 126184103) has the molecular formula C26H16F3NO7 and a molecular weight of 511.41 g/mol. Its IUPAC name is [2-(4-acetyloxyphenyl)-2-oxoethyl] 1,3-dioxo-2-[3-(trifluoromethyl)phenyl]isoindole-5-carboxylate.
| Compound Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 1,3-dioxo-2-[3-(trifluoromethyl)phenyl]isoindole-5-carboxylate |
|---|---|
| PubChem CID | 126184103 |
| Molecular Formula | C26H16F3NO7 |
| Molecular Weight | 511.41 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | [2-(4-acetyloxyphenyl)-2-oxoethyl] 1,3-dioxo-2-[3-(trifluoromethyl)phenyl]isoindole-5-carboxylate |
| SMILES | CC(=O)Oc1ccc(C(=O)COC(=O)c2ccc3c(c2)C(=O)N(c2cccc(C(F)(F)F)c2)C3=O)cc1 |
| InChI | InChI=1S/C26H16F3NO7/c1-14(31)37-19-8-5-15(6-9-19)22(32)13-36-25(35)16-7-10-20-21(11-16)24(34)30(23(20)33)18-4-2-3-17(12-18)26(27,28)29/h2-12H,13H2,1H3 |
| InChIKey | JFQUJPZXSZSNAX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|