C29H17F3N2O7 — CID 126182016
[3-(4-nitrophenoxy)phenyl]methyl 1,3-dioxo-2-[3-(trifluoromethyl)phenyl]isoindole-5-carboxylate (PubChem CID 126182016) has the molecular formula C29H17F3N2O7 and a molecular weight of 562.46 g/mol. Its IUPAC name is [3-(4-nitrophenoxy)phenyl]methyl 1,3-dioxo-2-[3-(trifluoromethyl)phenyl]isoindole-5-carboxylate.
| Compound Name | [3-(4-nitrophenoxy)phenyl]methyl 1,3-dioxo-2-[3-(trifluoromethyl)phenyl]isoindole-5-carboxylate |
|---|---|
| PubChem CID | 126182016 |
| Molecular Formula | C29H17F3N2O7 |
| Molecular Weight | 562.46 g/mol |
| Exact Mass | 562.10 |
| IUPAC Name | [3-(4-nitrophenoxy)phenyl]methyl 1,3-dioxo-2-[3-(trifluoromethyl)phenyl]isoindole-5-carboxylate |
| SMILES | O=C(OCc1cccc(Oc2ccc([N+](=O)[O-])cc2)c1)c1ccc2c(c1)C(=O)N(c1cccc(C(F)(F)F)c1)C2=O |
| InChI | InChI=1S/C29H17F3N2O7/c30-29(31,32)19-4-2-5-21(15-19)33-26(35)24-12-7-18(14-25(24)27(33)36)28(37)40-16-17-3-1-6-23(13-17)41-22-10-8-20(9-11-22)34(38)39/h1-15H,16H2 |
| InChIKey | BNLQKLYOZAPCIT-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.46 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|