C29H19N3O10 — CID 126188680
[3-(4-nitrophenoxy)phenyl]methyl 2-(4-methoxy-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 126188680) has the molecular formula C29H19N3O10 and a molecular weight of 569.48 g/mol. Its IUPAC name is [3-(4-nitrophenoxy)phenyl]methyl 2-(4-methoxy-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [3-(4-nitrophenoxy)phenyl]methyl 2-(4-methoxy-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 126188680 |
| Molecular Formula | C29H19N3O10 |
| Molecular Weight | 569.48 g/mol |
| Exact Mass | 569.11 |
| IUPAC Name | [3-(4-nitrophenoxy)phenyl]methyl 2-(4-methoxy-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccc(N2C(=O)c3ccc(C(=O)OCc4cccc(Oc5ccc([N+](=O)[O-])cc5)c4)cc3C2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H19N3O10/c1-40-21-10-12-25(26(15-21)32(38)39)30-27(33)23-11-5-18(14-24(23)28(30)34)29(35)41-16-17-3-2-4-22(13-17)42-20-8-6-19(7-9-20)31(36)37/h2-15H,16H2,1H3 |
| InChIKey | LUOVPHSKFHWPER-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 168.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|