C23H15ClN2O6 — CID 2935557
(4-chlorophenyl)methyl 2-(4-methyl-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 2935557) has the molecular formula C23H15ClN2O6 and a molecular weight of 450.83 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 2-(4-methyl-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | (4-chlorophenyl)methyl 2-(4-methyl-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 2935557 |
| Molecular Formula | C23H15ClN2O6 |
| Molecular Weight | 450.83 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | (4-chlorophenyl)methyl 2-(4-methyl-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1ccc(N2C(=O)c3ccc(C(=O)OCc4ccc(Cl)cc4)cc3C2=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H15ClN2O6/c1-13-2-9-19(20(10-13)26(30)31)25-21(27)17-8-5-15(11-18(17)22(25)28)23(29)32-12-14-3-6-16(24)7-4-14/h2-11H,12H2,1H3 |
| InChIKey | OESNTWSHFPXOMM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.83 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|