C15H7ClN2O6 — CID 23800567
2-(4-chloro-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 23800567) has the molecular formula C15H7ClN2O6 and a molecular weight of 346.68 g/mol. Its IUPAC name is 2-(4-chloro-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-(4-chloro-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 23800567 |
| Molecular Formula | C15H7ClN2O6 |
| Molecular Weight | 346.68 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 2-(4-chloro-2-nitrophenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(c1ccc(Cl)cc1[N+](=O)[O-])C2=O |
| InChI | InChI=1S/C15H7ClN2O6/c16-8-2-4-11(12(6-8)18(23)24)17-13(19)9-3-1-7(15(21)22)5-10(9)14(17)20/h1-6H,(H,21,22) |
| InChIKey | MRTLADCQHSQEKU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.68 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|