C15H9NO5 — CID 746439
2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 746439) has the molecular formula C15H9NO5 and a molecular weight of 283.24 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 746439 |
| Molecular Formula | C15H9NO5 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 2-(2-hydroxyphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(c1ccccc1O)C2=O |
| InChI | InChI=1S/C15H9NO5/c17-12-4-2-1-3-11(12)16-13(18)9-6-5-8(15(20)21)7-10(9)14(16)19/h1-7,17H,(H,20,21) |
| InChIKey | LOCUVUONCCLSGK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|