C34H26N2O8 — CID 139199918
2-(2,6-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 139199918) has the molecular formula C34H26N2O8 and a molecular weight of 590.59 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-(2,6-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 139199918 |
| Molecular Formula | C34H26N2O8 |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | Cc1cccc(C)c1N1C(=O)c2ccc(C(=O)O)cc2C1=O.Cc1cccc(C)c1N1C(=O)c2ccc(C(=O)O)cc2C1=O |
| InChI | InChI=1S/2C17H13NO4/c2*1-9-4-3-5-10(2)14(9)18-15(19)12-7-6-11(17(21)22)8-13(12)16(18)20/h2*3-8H,1-2H3,(H,21,22) |
| InChIKey | ZVTNNYYGKZAZFS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|