C25H22N2O3 — CID 9320693
N-benzyl-1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindole-5-carboxamide (PubChem CID 9320693) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is N-benzyl-1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindole-5-carboxamide.
| Compound Name | N-benzyl-1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 9320693 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-benzyl-1,3-dioxo-2-(2,4,6-trimethylphenyl)isoindole-5-carboxamide |
| SMILES | Cc1cc(C)c(N2C(=O)c3ccc(C(=O)NCc4ccccc4)cc3C2=O)c(C)c1 |
| InChI | InChI=1S/C25H22N2O3/c1-15-11-16(2)22(17(3)12-15)27-24(29)20-10-9-19(13-21(20)25(27)30)23(28)26-14-18-7-5-4-6-8-18/h4-13H,14H2,1-3H3,(H,26,28) |
| InChIKey | NQWIERBULQYFHK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|