C22H17N3O3 — CID 1026487
N-benzyl-1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carboxamide (PubChem CID 1026487) has the molecular formula C22H17N3O3 and a molecular weight of 371.40 g/mol. Its IUPAC name is N-benzyl-1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carboxamide.
| Compound Name | N-benzyl-1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carboxamide |
|---|---|
| PubChem CID | 1026487 |
| Molecular Formula | C22H17N3O3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | N-benzyl-1,3-dioxo-2-(pyridin-3-ylmethyl)isoindole-5-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc2c(c1)C(=O)N(Cc1cccnc1)C2=O |
| InChI | InChI=1S/C22H17N3O3/c26-20(24-13-15-5-2-1-3-6-15)17-8-9-18-19(11-17)22(28)25(21(18)27)14-16-7-4-10-23-12-16/h1-12H,13-14H2,(H,24,26) |
| InChIKey | GJKCJJLUOJOWIS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|