C28H23N5O3 — CID 58930493
N-(2-aminophenyl)-4-[[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-5-yl]amino]methyl]benzamide (PubChem CID 58930493) has the molecular formula C28H23N5O3 and a molecular weight of 477.52 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-5-yl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-5-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 58930493 |
| Molecular Formula | C28H23N5O3 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-5-yl]amino]methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNc2ccc3c(c2)C(=O)N(Cc2cccnc2)C3=O)cc1 |
| InChI | InChI=1S/C28H23N5O3/c29-24-5-1-2-6-25(24)32-26(34)20-9-7-18(8-10-20)16-31-21-11-12-22-23(14-21)28(36)33(27(22)35)17-19-4-3-13-30-15-19/h1-15,31H,16-17,29H2,(H,32,34) |
| InChIKey | WZZZHHLCLGYVTL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|