C21H23N4O7P — CID 67397836
phosphoric acid;pyridin-3-ylmethyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 67397836) has the molecular formula C21H23N4O7P and a molecular weight of 474.41 g/mol. Its IUPAC name is phosphoric acid;pyridin-3-ylmethyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate.
| Compound Name | phosphoric acid;pyridin-3-ylmethyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 67397836 |
| Molecular Formula | C21H23N4O7P |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | phosphoric acid;pyridin-3-ylmethyl N-[[4-[(2-aminophenyl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CNC(=O)OCc2cccnc2)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C21H20N4O3.H3O4P/c22-18-5-1-2-6-19(18)25-20(26)17-9-7-15(8-10-17)13-24-21(27)28-14-16-4-3-11-23-12-16;1-5(2,3)4/h1-12H,13-14,22H2,(H,24,27)(H,25,26);(H3,1,2,3,4) |
| InChIKey | VVJWXCYOOVSBOT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 184.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|