C15H15N3O4 — CID 10990261
pyridin-3-ylmethyl N-[[4-(hydroxycarbamoyl)phenyl]methyl]carbamate (PubChem CID 10990261) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-[[4-(hydroxycarbamoyl)phenyl]methyl]carbamate.
| Compound Name | pyridin-3-ylmethyl N-[[4-(hydroxycarbamoyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 10990261 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | pyridin-3-ylmethyl N-[[4-(hydroxycarbamoyl)phenyl]methyl]carbamate |
| SMILES | O=C(NCc1ccc(C(=O)NO)cc1)OCc1cccnc1 |
| InChI | InChI=1S/C15H15N3O4/c19-14(18-21)13-5-3-11(4-6-13)9-17-15(20)22-10-12-2-1-7-16-8-12/h1-8,21H,9-10H2,(H,17,20)(H,18,19) |
| InChIKey | ODRTWSVECUXYQO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|