C26H23N5O3 — CID 59737468
pyridin-3-ylmethyl N-[[4-[(2-amino-5-pyridin-4-ylphenyl)carbamoyl]phenyl]methyl]carbamate (PubChem CID 59737468) has the molecular formula C26H23N5O3 and a molecular weight of 453.50 g/mol. Its IUPAC name is pyridin-3-ylmethyl N-[[4-[(2-amino-5-pyridin-4-ylphenyl)carbamoyl]phenyl]methyl]carbamate.
| Compound Name | pyridin-3-ylmethyl N-[[4-[(2-amino-5-pyridin-4-ylphenyl)carbamoyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 59737468 |
| Molecular Formula | C26H23N5O3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | pyridin-3-ylmethyl N-[[4-[(2-amino-5-pyridin-4-ylphenyl)carbamoyl]phenyl]methyl]carbamate |
| SMILES | Nc1ccc(-c2ccncc2)cc1NC(=O)c1ccc(CNC(=O)OCc2cccnc2)cc1 |
| InChI | InChI=1S/C26H23N5O3/c27-23-8-7-22(20-9-12-28-13-10-20)14-24(23)31-25(32)21-5-3-18(4-6-21)16-30-26(33)34-17-19-2-1-11-29-15-19/h1-15H,16-17,27H2,(H,30,33)(H,31,32) |
| InChIKey | UJIOXLVLDMGRRT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|