C25H21N3O4S — CID 66894999
[4-[(2-hydroxy-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl N-(pyridin-3-ylmethyl)carbamate (PubChem CID 66894999) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is [4-[(2-hydroxy-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl N-(pyridin-3-ylmethyl)carbamate.
| Compound Name | [4-[(2-hydroxy-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl N-(pyridin-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 66894999 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [4-[(2-hydroxy-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl N-(pyridin-3-ylmethyl)carbamate |
| SMILES | O=C(NCc1cccnc1)OCc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2O)cc1 |
| InChI | InChI=1S/C25H21N3O4S/c29-22-10-9-20(23-4-2-12-33-23)13-21(22)28-24(30)19-7-5-17(6-8-19)16-32-25(31)27-15-18-3-1-11-26-14-18/h1-14,29H,15-16H2,(H,27,31)(H,28,30) |
| InChIKey | AMKCAHCDRAMIBC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|