C26H25N3O3PS+ — CID 173062928
[1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-methyl-3-pyridin-3-ylpropan-2-yl]oxy-oxophosphanium (PubChem CID 173062928) has the molecular formula C26H25N3O3PS+ and a molecular weight of 490.55 g/mol. Its IUPAC name is [1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-methyl-3-pyridin-3-ylpropan-2-yl]oxy-oxophosphanium.
| Compound Name | [1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-methyl-3-pyridin-3-ylpropan-2-yl]oxy-oxophosphanium |
|---|---|
| PubChem CID | 173062928 |
| Molecular Formula | C26H25N3O3PS+ |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | [1-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2-methyl-3-pyridin-3-ylpropan-2-yl]oxy-oxophosphanium |
| SMILES | CC(Cc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1)(Cc1cccnc1)O[PH+]=O |
| InChI | InChI=1S/C26H24N3O3PS/c1-26(32-33-31,16-19-4-2-12-28-17-19)15-18-6-8-20(9-7-18)25(30)29-23-14-21(10-11-22(23)27)24-5-3-13-34-24/h2-14,17,33H,15-16,27H2,1H3/p+1 |
| InChIKey | JNMVHFDLFVNTDF-UHFFFAOYSA-O |
| XLogP | 6.14 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|