C24H28N2O2PS+ — CID 154074694
[3-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2,4-dimethylpentan-3-yl]-oxophosphanium (PubChem CID 154074694) has the molecular formula C24H28N2O2PS+ and a molecular weight of 439.54 g/mol. Its IUPAC name is [3-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2,4-dimethylpentan-3-yl]-oxophosphanium.
| Compound Name | [3-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2,4-dimethylpentan-3-yl]-oxophosphanium |
|---|---|
| PubChem CID | 154074694 |
| Molecular Formula | C24H28N2O2PS+ |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | [3-[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]-2,4-dimethylpentan-3-yl]-oxophosphanium |
| SMILES | CC(C)C([PH+]=O)(c1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1)C(C)C |
| InChI | InChI=1S/C24H27N2O2PS/c1-15(2)24(29-28,16(3)4)19-10-7-17(8-11-19)23(27)26-21-14-18(9-12-20(21)25)22-6-5-13-30-22/h5-16H,25H2,1-4H3,(H,26,27)/p+1 |
| InChIKey | QPHPFBNDCQVKAL-UHFFFAOYSA-O |
| XLogP | 6.78 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|