C18H16N2OS2 — CID 168913825
N-(2-amino-5-thiophen-2-ylphenyl)-4-methylsulfanylbenzamide (PubChem CID 168913825) has the molecular formula C18H16N2OS2 and a molecular weight of 340.47 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-methylsulfanylbenzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 168913825 |
| Molecular Formula | C18H16N2OS2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-methylsulfanylbenzamide |
| SMILES | CSc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C18H16N2OS2/c1-22-14-7-4-12(5-8-14)18(21)20-16-11-13(6-9-15(16)19)17-3-2-10-23-17/h2-11H,19H2,1H3,(H,20,21) |
| InChIKey | LIASAHACDVFKTP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|