C19H17N2O2PS — CID 88928326
CID 88928326 (PubChem CID 88928326) has the molecular formula C19H17N2O2PS and a molecular weight of 368.40 g/mol.
| Compound Name | CID 88928326 |
|---|---|
| PubChem CID | 88928326 |
| Molecular Formula | C19H17N2O2PS |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | — |
| SMILES | C=[P+]([O-])Cc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C19H17N2O2PS/c1-24(23)12-13-4-6-14(7-5-13)19(22)21-17-11-15(8-9-16(17)20)18-3-2-10-25-18/h2-11H,1,12,20H2,(H,21,22) |
| InChIKey | LFXRMOUIXDSIRJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 78.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|