C24H20N2O3PS+ — CID 68999115
[2-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]phenyl]-hydroxy-oxophosphanium (PubChem CID 68999115) has the molecular formula C24H20N2O3PS+ and a molecular weight of 447.48 g/mol. Its IUPAC name is [2-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]phenyl]-hydroxy-oxophosphanium.
| Compound Name | [2-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]phenyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 68999115 |
| Molecular Formula | C24H20N2O3PS+ |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | [2-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]phenyl]-hydroxy-oxophosphanium |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(Cc2ccccc2[P+](=O)O)cc1 |
| InChI | InChI=1S/C24H19N2O3PS/c25-20-12-11-19(23-6-3-13-31-23)15-21(20)26-24(27)17-9-7-16(8-10-17)14-18-4-1-2-5-22(18)30(28)29/h1-13,15H,14,25H2,(H-,26,27,28,29)/p+1 |
| InChIKey | ZBJJPGLEONANEX-UHFFFAOYSA-O |
| XLogP | 5.20 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|