C25H21N3O3S — CID 90890789
[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl N-phenylcarbamate (PubChem CID 90890789) has the molecular formula C25H21N3O3S and a molecular weight of 443.53 g/mol. Its IUPAC name is [4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl N-phenylcarbamate.
| Compound Name | [4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl N-phenylcarbamate |
|---|---|
| PubChem CID | 90890789 |
| Molecular Formula | C25H21N3O3S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | [4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl N-phenylcarbamate |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(COC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C25H21N3O3S/c26-21-13-12-19(23-7-4-14-32-23)15-22(21)28-24(29)18-10-8-17(9-11-18)16-31-25(30)27-20-5-2-1-3-6-20/h1-15H,16,26H2,(H,27,30)(H,28,29) |
| InChIKey | PHRICUHYPUWWNQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|