C25H31N2O4PS — CID 69039696
N-(2-amino-5-thiophen-2-ylphenyl)-4-[[ethyl-(3-hydroxy-3-methylbutyl)phosphoryl]oxymethyl]benzamide (PubChem CID 69039696) has the molecular formula C25H31N2O4PS and a molecular weight of 486.57 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[[ethyl-(3-hydroxy-3-methylbutyl)phosphoryl]oxymethyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[ethyl-(3-hydroxy-3-methylbutyl)phosphoryl]oxymethyl]benzamide |
|---|---|
| PubChem CID | 69039696 |
| Molecular Formula | C25H31N2O4PS |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[ethyl-(3-hydroxy-3-methylbutyl)phosphoryl]oxymethyl]benzamide |
| SMILES | CCP(=O)(CCC(C)(C)O)OCc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C25H31N2O4PS/c1-4-32(30,14-13-25(2,3)29)31-17-18-7-9-19(10-8-18)24(28)27-22-16-20(11-12-21(22)26)23-6-5-15-33-23/h5-12,15-16,29H,4,13-14,17,26H2,1-3H3,(H,27,28) |
| InChIKey | OCNRHAZTYHVQAV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|