C23H27N2O4PS — CID 90864626
N-(2-amino-5-thiophen-2-ylphenyl)-4-[(3-hydroxy-3-methylbutyl)-methylphosphoryl]oxybenzamide (PubChem CID 90864626) has the molecular formula C23H27N2O4PS and a molecular weight of 458.52 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[(3-hydroxy-3-methylbutyl)-methylphosphoryl]oxybenzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[(3-hydroxy-3-methylbutyl)-methylphosphoryl]oxybenzamide |
|---|---|
| PubChem CID | 90864626 |
| Molecular Formula | C23H27N2O4PS |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[(3-hydroxy-3-methylbutyl)-methylphosphoryl]oxybenzamide |
| SMILES | CC(C)(O)CCP(C)(=O)Oc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C23H27N2O4PS/c1-23(2,27)12-13-30(3,28)29-18-9-6-16(7-10-18)22(26)25-20-15-17(8-11-19(20)24)21-5-4-14-31-21/h4-11,14-15,27H,12-13,24H2,1-3H3,(H,25,26) |
| InChIKey | VKAMGGFAWCJDNS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|