C22H25N2O3PS — CID 143614034
N-(2-amino-5-thiophen-2-ylphenyl)-4-[2-[ethoxy(methyl)phosphanyl]oxyethyl]benzamide (PubChem CID 143614034) has the molecular formula C22H25N2O3PS and a molecular weight of 428.49 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[2-[ethoxy(methyl)phosphanyl]oxyethyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[2-[ethoxy(methyl)phosphanyl]oxyethyl]benzamide |
|---|---|
| PubChem CID | 143614034 |
| Molecular Formula | C22H25N2O3PS |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[2-[ethoxy(methyl)phosphanyl]oxyethyl]benzamide |
| SMILES | CCOP(C)OCCc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C22H25N2O3PS/c1-3-26-28(2)27-13-12-16-6-8-17(9-7-16)22(25)24-20-15-18(10-11-19(20)23)21-5-4-14-29-21/h4-11,14-15H,3,12-13,23H2,1-2H3,(H,24,25) |
| InChIKey | BMLCJKYQPPYOHS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|