C21H23N2O3PS — CID 143614063
N-(2-amino-5-thiophen-2-ylphenyl)-4-[1-[methoxy(methyl)phosphanyl]oxyethyl]benzamide (PubChem CID 143614063) has the molecular formula C21H23N2O3PS and a molecular weight of 414.47 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[1-[methoxy(methyl)phosphanyl]oxyethyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[1-[methoxy(methyl)phosphanyl]oxyethyl]benzamide |
|---|---|
| PubChem CID | 143614063 |
| Molecular Formula | C21H23N2O3PS |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[1-[methoxy(methyl)phosphanyl]oxyethyl]benzamide |
| SMILES | COP(C)OC(C)c1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C21H23N2O3PS/c1-14(26-27(3)25-2)15-6-8-16(9-7-15)21(24)23-19-13-17(10-11-18(19)22)20-5-4-12-28-20/h4-14H,22H2,1-3H3,(H,23,24) |
| InChIKey | UEGVBXXJMRVXPY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|