C22H25N2O2PS — CID 143614082
N-(2-amino-5-thiophen-2-ylphenyl)-3-[[methyl(propan-2-yloxy)phosphanyl]methyl]benzamide (PubChem CID 143614082) has the molecular formula C22H25N2O2PS and a molecular weight of 412.50 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-3-[[methyl(propan-2-yloxy)phosphanyl]methyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-3-[[methyl(propan-2-yloxy)phosphanyl]methyl]benzamide |
|---|---|
| PubChem CID | 143614082 |
| Molecular Formula | C22H25N2O2PS |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-3-[[methyl(propan-2-yloxy)phosphanyl]methyl]benzamide |
| SMILES | CC(C)OP(C)Cc1cccc(C(=O)Nc2cc(-c3cccs3)ccc2N)c1 |
| InChI | InChI=1S/C22H25N2O2PS/c1-15(2)26-27(3)14-16-6-4-7-18(12-16)22(25)24-20-13-17(9-10-19(20)23)21-8-5-11-28-21/h4-13,15H,14,23H2,1-3H3,(H,24,25) |
| InChIKey | QURCCIKPXFSDJO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|