C36H30N4O5PS2+ — CID 69000333
bis[[3-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methoxy]-oxophosphanium (PubChem CID 69000333) has the molecular formula C36H30N4O5PS2+ and a molecular weight of 693.77 g/mol. Its IUPAC name is bis[[3-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methoxy]-oxophosphanium.
| Compound Name | bis[[3-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methoxy]-oxophosphanium |
|---|---|
| PubChem CID | 69000333 |
| Molecular Formula | C36H30N4O5PS2+ |
| Molecular Weight | 693.77 g/mol |
| Exact Mass | 693.14 |
| IUPAC Name | bis[[3-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methoxy]-oxophosphanium |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1cccc(CO[P+](=O)OCc2cccc(C(=O)Nc3cc(-c4cccs4)ccc3N)c2)c1 |
| InChI | InChI=1S/C36H29N4O5PS2/c37-29-13-11-25(33-9-3-15-47-33)19-31(29)39-35(41)27-7-1-5-23(17-27)21-44-46(43)45-22-24-6-2-8-28(18-24)36(42)40-32-20-26(12-14-30(32)38)34-10-4-16-48-34/h1-20H,21-22,37-38H2,(H-,39,40,41,42)/p+1 |
| InChIKey | LBBVDMHPQZYPRX-UHFFFAOYSA-O |
| XLogP | 9.20 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.77 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|