C19H18N2O3S — CID 59736817
N-(2-amino-5-thiophen-2-ylphenyl)-3,4-dimethoxybenzamide (PubChem CID 59736817) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-3,4-dimethoxybenzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 59736817 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1OC |
| InChI | InChI=1S/C19H18N2O3S/c1-23-16-8-6-13(11-17(16)24-2)19(22)21-15-10-12(5-7-14(15)20)18-4-3-9-25-18/h3-11H,20H2,1-2H3,(H,21,22) |
| InChIKey | WLQSOEXBALPJLL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|