C26H23N3O3S — CID 69101116
N-(2-amino-5-thiophen-2-ylphenyl)-3-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]prop-2-enamide (PubChem CID 69101116) has the molecular formula C26H23N3O3S and a molecular weight of 457.56 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-3-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]prop-2-enamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-3-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 69101116 |
| Molecular Formula | C26H23N3O3S |
| Molecular Weight | 457.56 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-3-[6-(3,4-dimethoxyphenyl)-3-pyridinyl]prop-2-enamide |
| SMILES | COc1ccc(-c2ccc(C=CC(=O)Nc3cc(-c4cccs4)ccc3N)cn2)cc1OC |
| InChI | InChI=1S/C26H23N3O3S/c1-31-23-11-8-18(15-24(23)32-2)21-10-5-17(16-28-21)6-12-26(30)29-22-14-19(7-9-20(22)27)25-4-3-13-33-25/h3-16H,27H2,1-2H3,(H,29,30) |
| InChIKey | GHTFQLKQNRMSGJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|