C29H29N3O4S — CID 66894963
(Z)-N-(2-amino-5-thiophen-2-ylphenyl)-3-[4-[(3,4,5-trimethoxyanilino)methyl]phenyl]prop-2-enamide (PubChem CID 66894963) has the molecular formula C29H29N3O4S and a molecular weight of 515.64 g/mol. Its IUPAC name is (Z)-N-(2-amino-5-thiophen-2-ylphenyl)-3-[4-[(3,4,5-trimethoxyanilino)methyl]phenyl]prop-2-enamide.
| Compound Name | (Z)-N-(2-amino-5-thiophen-2-ylphenyl)-3-[4-[(3,4,5-trimethoxyanilino)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 66894963 |
| Molecular Formula | C29H29N3O4S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | (Z)-N-(2-amino-5-thiophen-2-ylphenyl)-3-[4-[(3,4,5-trimethoxyanilino)methyl]phenyl]prop-2-enamide |
| SMILES | COc1cc(NCc2ccc(/C=C\C(=O)Nc3cc(-c4cccs4)ccc3N)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H29N3O4S/c1-34-25-16-22(17-26(35-2)29(25)36-3)31-18-20-8-6-19(7-9-20)10-13-28(33)32-24-15-21(11-12-23(24)30)27-5-4-14-37-27/h4-17,31H,18,30H2,1-3H3,(H,32,33)/b13-10- |
| InChIKey | MNFDDTNSMSDHOM-RAXLEYEMSA-N |
| XLogP | 6.29 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|