C22H22N2O3PS+ — CID 140541716
[3-[(E)-3-(2-amino-5-thiophen-2-ylanilino)-3-oxoprop-1-enyl]phenyl]methyl-ethoxy-oxophosphanium (PubChem CID 140541716) has the molecular formula C22H22N2O3PS+ and a molecular weight of 425.47 g/mol. Its IUPAC name is [3-[(E)-3-(2-amino-5-thiophen-2-ylanilino)-3-oxoprop-1-enyl]phenyl]methyl-ethoxy-oxophosphanium.
| Compound Name | [3-[(E)-3-(2-amino-5-thiophen-2-ylanilino)-3-oxoprop-1-enyl]phenyl]methyl-ethoxy-oxophosphanium |
|---|---|
| PubChem CID | 140541716 |
| Molecular Formula | C22H22N2O3PS+ |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | [3-[(E)-3-(2-amino-5-thiophen-2-ylanilino)-3-oxoprop-1-enyl]phenyl]methyl-ethoxy-oxophosphanium |
| SMILES | CCO[P+](=O)Cc1cccc(/C=C/C(=O)Nc2cc(-c3cccs3)ccc2N)c1 |
| InChI | InChI=1S/C22H21N2O3PS/c1-2-27-28(26)15-17-6-3-5-16(13-17)8-11-22(25)24-20-14-18(9-10-19(20)23)21-7-4-12-29-21/h3-14H,2,15,23H2,1H3/p+1/b11-8+ |
| InChIKey | NCXMQVFRBASVEV-DHZHZOJOSA-O |
| XLogP | 5.93 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|