C26H28N4OS — CID 121341035
(E)-N-(2-amino-5-thiophen-2-ylphenyl)-3-(3-cyclopropyl-4-piperazin-1-ylphenyl)prop-2-enamide (PubChem CID 121341035) has the molecular formula C26H28N4OS and a molecular weight of 444.60 g/mol. Its IUPAC name is (E)-N-(2-amino-5-thiophen-2-ylphenyl)-3-(3-cyclopropyl-4-piperazin-1-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-amino-5-thiophen-2-ylphenyl)-3-(3-cyclopropyl-4-piperazin-1-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 121341035 |
| Molecular Formula | C26H28N4OS |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (E)-N-(2-amino-5-thiophen-2-ylphenyl)-3-(3-cyclopropyl-4-piperazin-1-ylphenyl)prop-2-enamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)/C=C/c1ccc(N2CCNCC2)c(C2CC2)c1 |
| InChI | InChI=1S/C26H28N4OS/c27-22-8-7-20(25-2-1-15-32-25)17-23(22)29-26(31)10-4-18-3-9-24(21(16-18)19-5-6-19)30-13-11-28-12-14-30/h1-4,7-10,15-17,19,28H,5-6,11-14,27H2,(H,29,31)/b10-4+ |
| InChIKey | FELYTFXSKKJFCY-ONNFQVAWSA-N |
| XLogP | 4.94 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|