C16H20N4OS — CID 71465922
N-(2-amino-5-thiophen-2-ylphenyl)-4-methylpiperazine-1-carboxamide (PubChem CID 71465922) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-methylpiperazine-1-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 71465922 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-methylpiperazine-1-carboxamide |
| SMILES | CN1CCN(C(=O)Nc2cc(-c3cccs3)ccc2N)CC1 |
| InChI | InChI=1S/C16H20N4OS/c1-19-6-8-20(9-7-19)16(21)18-14-11-12(4-5-13(14)17)15-3-2-10-22-15/h2-5,10-11H,6-9,17H2,1H3,(H,18,21) |
| InChIKey | GDMIRTGJCDZTLU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|