C26H28IN3O3S — CID 69107341
N-(2-amino-5-thiophen-2-ylphenyl)-4-(2-hydroxy-3-iodo-3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)benzamide (PubChem CID 69107341) has the molecular formula C26H28IN3O3S and a molecular weight of 589.50 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-(2-hydroxy-3-iodo-3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-(2-hydroxy-3-iodo-3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 69107341 |
| Molecular Formula | C26H28IN3O3S |
| Molecular Weight | 589.50 g/mol |
| Exact Mass | 589.09 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-(2-hydroxy-3-iodo-3-methyl-1-oxo-1-pyrrolidin-1-ylbutan-2-yl)benzamide |
| SMILES | CC(C)(I)C(O)(C(=O)N1CCCC1)c1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C26H28IN3O3S/c1-25(2,27)26(33,24(32)30-13-3-4-14-30)19-10-7-17(8-11-19)23(31)29-21-16-18(9-12-20(21)28)22-6-5-15-34-22/h5-12,15-16,33H,3-4,13-14,28H2,1-2H3,(H,29,31) |
| InChIKey | XMGLMGYSBNQNPM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|