C24H27N3OS — CID 69101017
N-(2-amino-5-thiophen-2-ylphenyl)-4-[[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]methyl]benzamide (PubChem CID 69101017) has the molecular formula C24H27N3OS and a molecular weight of 405.57 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]methyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 69101017 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]methyl]benzamide |
| SMILES | C[C@@H]1CC[C@@H](C)N1Cc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C24H27N3OS/c1-16-5-6-17(2)27(16)15-18-7-9-19(10-8-18)24(28)26-22-14-20(11-12-21(22)25)23-4-3-13-29-23/h3-4,7-14,16-17H,5-6,15,25H2,1-2H3,(H,26,28)/t16-,17-/m1/s1 |
| InChIKey | LLHUGJSYJLGTOF-IAGOWNOFSA-N |
| XLogP | 5.62 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|