C25H25N3O3S — CID 139460401
N-(2-amino-5-thiophen-2-ylphenyl)-4-[(6-oxo-2-oxa-5-azaspiro[3.5]nonan-5-yl)methyl]benzamide (PubChem CID 139460401) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[(6-oxo-2-oxa-5-azaspiro[3.5]nonan-5-yl)methyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[(6-oxo-2-oxa-5-azaspiro[3.5]nonan-5-yl)methyl]benzamide |
|---|---|
| PubChem CID | 139460401 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[(6-oxo-2-oxa-5-azaspiro[3.5]nonan-5-yl)methyl]benzamide |
| SMILES | Nc1ccc(-c2cccs2)cc1NC(=O)c1ccc(CN2C(=O)CCCC23COC3)cc1 |
| InChI | InChI=1S/C25H25N3O3S/c26-20-10-9-19(22-3-2-12-32-22)13-21(20)27-24(30)18-7-5-17(6-8-18)14-28-23(29)4-1-11-25(28)15-31-16-25/h2-3,5-10,12-13H,1,4,11,14-16,26H2,(H,27,30) |
| InChIKey | JETFINCWLULJJO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|