C23H27N3O2PS+ — CID 67317506
N-(2-amino-5-thiophen-2-ylphenyl)-4-[(4-hydroxy-1-methyl-1,4-azaphosphinan-4-ium-4-yl)methyl]benzamide (PubChem CID 67317506) has the molecular formula C23H27N3O2PS+ and a molecular weight of 440.53 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[(4-hydroxy-1-methyl-1,4-azaphosphinan-4-ium-4-yl)methyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[(4-hydroxy-1-methyl-1,4-azaphosphinan-4-ium-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 67317506 |
| Molecular Formula | C23H27N3O2PS+ |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[(4-hydroxy-1-methyl-1,4-azaphosphinan-4-ium-4-yl)methyl]benzamide |
| SMILES | CN1CC[P+](O)(Cc2ccc(C(=O)Nc3cc(-c4cccs4)ccc3N)cc2)CC1 |
| InChI | InChI=1S/C23H26N3O2PS/c1-26-10-12-29(28,13-11-26)16-17-4-6-18(7-5-17)23(27)25-21-15-19(8-9-20(21)24)22-3-2-14-30-22/h2-9,14-15,28H,10-13,16,24H2,1H3/p+1 |
| InChIKey | XCKUGVCFJHQROO-UHFFFAOYSA-O |
| XLogP | 4.62 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|