C24H26N4O2S — CID 69100695
4-[(3-acetamidopyrrolidin-1-yl)methyl]-N-(2-amino-5-thiophen-2-ylphenyl)benzamide (PubChem CID 69100695) has the molecular formula C24H26N4O2S and a molecular weight of 434.57 g/mol. Its IUPAC name is 4-[(3-acetamidopyrrolidin-1-yl)methyl]-N-(2-amino-5-thiophen-2-ylphenyl)benzamide.
| Compound Name | 4-[(3-acetamidopyrrolidin-1-yl)methyl]-N-(2-amino-5-thiophen-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 69100695 |
| Molecular Formula | C24H26N4O2S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 4-[(3-acetamidopyrrolidin-1-yl)methyl]-N-(2-amino-5-thiophen-2-ylphenyl)benzamide |
| SMILES | CC(=O)NC1CCN(Cc2ccc(C(=O)Nc3cc(-c4cccs4)ccc3N)cc2)C1 |
| InChI | InChI=1S/C24H26N4O2S/c1-16(29)26-20-10-11-28(15-20)14-17-4-6-18(7-5-17)24(30)27-22-13-19(8-9-21(22)25)23-3-2-12-31-23/h2-9,12-13,20H,10-11,14-15,25H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | UGKLJDPAOLTMKK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|