C22H23N2O3PS — CID 67316902
[1-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]cyclopropyl]-methylphosphinic acid (PubChem CID 67316902) has the molecular formula C22H23N2O3PS and a molecular weight of 426.48 g/mol. Its IUPAC name is [1-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]cyclopropyl]-methylphosphinic acid.
| Compound Name | [1-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]cyclopropyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 67316902 |
| Molecular Formula | C22H23N2O3PS |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [1-[[4-[(2-amino-5-thiophen-2-ylphenyl)carbamoyl]phenyl]methyl]cyclopropyl]-methylphosphinic acid |
| SMILES | CP(=O)(O)C1(Cc2ccc(C(=O)Nc3cc(-c4cccs4)ccc3N)cc2)CC1 |
| InChI | InChI=1S/C22H23N2O3PS/c1-28(26,27)22(10-11-22)14-15-4-6-16(7-5-15)21(25)24-19-13-17(8-9-18(19)23)20-3-2-12-29-20/h2-9,12-13H,10-11,14,23H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | WVHRVYSRZOYUAT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|