C22H28N5O2PS — CID 91383957
N-(2-amino-5-thiophen-2-ylphenyl)-4-[[[bis(dimethylamino)-hydroxy-λ5-phosphanylidene]amino]methyl]benzamide (PubChem CID 91383957) has the molecular formula C22H28N5O2PS and a molecular weight of 457.54 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[[[bis(dimethylamino)-hydroxy-λ5-phosphanylidene]amino]methyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[[bis(dimethylamino)-hydroxy-λ5-phosphanylidene]amino]methyl]benzamide |
|---|---|
| PubChem CID | 91383957 |
| Molecular Formula | C22H28N5O2PS |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[[bis(dimethylamino)-hydroxy-λ5-phosphanylidene]amino]methyl]benzamide |
| SMILES | CN(C)P(O)(=NCc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1)N(C)C |
| InChI | InChI=1S/C22H28N5O2PS/c1-26(2)30(29,27(3)4)24-15-16-7-9-17(10-8-16)22(28)25-20-14-18(11-12-19(20)23)21-6-5-13-31-21/h5-14,29H,15,23H2,1-4H3,(H,25,28) |
| InChIKey | LCDLYRAZCHINER-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|