C23H28N4OS — CID 69101574
N-(2-amino-5-thiophen-2-ylphenyl)-4-[[3-(dimethylamino)propylamino]methyl]benzamide (PubChem CID 69101574) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[[3-(dimethylamino)propylamino]methyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[3-(dimethylamino)propylamino]methyl]benzamide |
|---|---|
| PubChem CID | 69101574 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[[3-(dimethylamino)propylamino]methyl]benzamide |
| SMILES | CN(C)CCCNCc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1 |
| InChI | InChI=1S/C23H28N4OS/c1-27(2)13-4-12-25-16-17-6-8-18(9-7-17)23(28)26-21-15-19(10-11-20(21)24)22-5-3-14-29-22/h3,5-11,14-15,25H,4,12-13,16,24H2,1-2H3,(H,26,28) |
| InChIKey | BCZFDWNXPVOADP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|